piperazine;sulfuric acid

C8H22N4O4S — CID 131986389

IUPACpiperazine;sulfuric acid
SMILESC1CNCCN1.C1CNCCN1.O=S(=O)(O)O
InChIInChI=1S/2C4H10N2.H2O4S/c2*1-2-6-4-3-5-1;1-5(2,3)4/h2*5-6H,1-4H2;(H2,1,2,3,4)
InChIKeyWKDROHPCPSLGLA-UHFFFAOYSA-N
MW270.36 g/mol
LogP-2.29
Rot. Bonds

About piperazine;sulfuric acid

piperazine;sulfuric acid (PubChem CID 131986389) has the molecular formula C8H22N4O4S and a molecular weight of 270.36 g/mol. Its IUPAC name is piperazine;sulfuric acid.

Molecular Properties

Compound Namepiperazine;sulfuric acid
PubChem CID131986389
Molecular FormulaC8H22N4O4S
Molecular Weight270.36 g/mol
Exact Mass270.14
IUPAC Namepiperazine;sulfuric acid
SMILESC1CNCCN1.C1CNCCN1.O=S(=O)(O)O
InChIInChI=1S/2C4H10N2.H2O4S/c2*1-2-6-4-3-5-1;1-5(2,3)4/h2*5-6H,1-4H2;(H2,1,2,3,4)
InChIKeyWKDROHPCPSLGLA-UHFFFAOYSA-N
XLogP-2.29
TPSA122.72 Ų
H-Bond Donors6
H-Bond Acceptors6
Rotatable Bonds
Heavy Atoms17
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500270.36
LogP ≤ 5-2.29
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze piperazine;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of piperazine;sulfuric acid?
The IUPAC name of piperazine;sulfuric acid (CID 131986389) is piperazine;sulfuric acid.
What is the SMILES notation for piperazine;sulfuric acid?
The canonical SMILES for piperazine;sulfuric acid is C1CNCCN1.C1CNCCN1.O=S(=O)(O)O.
What is the InChIKey of piperazine;sulfuric acid?
The InChIKey is WKDROHPCPSLGLA-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H10N2.H2O4S/c2*1-2-6-4-3-5-1;1-5(2,3)4/h2*5-6H,1-4H2;(H2,1,2,3,4).
What are the key properties of piperazine;sulfuric acid?
piperazine;sulfuric acid has a molecular weight of 270.36 g/mol, XLogP of -2.29, 0 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for piperazine;sulfuric acid is sourced from PubChem (CID 131986389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).