About CID 131986407
CID 131986407 (PubChem CID 131986407) has the molecular formula C13H16N2NaO2S
and a molecular weight of 287.34 g/mol.
Molecular Properties
| Compound Name | CID 131986407 |
| PubChem CID | 131986407 |
| Molecular Formula | C13H16N2NaO2S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | — |
| SMILES | C=CCC1(C2C=CCCC2)C(=O)NC(=S)NC1=O.[Na] |
| InChI | InChI=1S/C13H16N2O2S.Na/c1-2-8-13(9-6-4-3-5-7-9)10(16)14-12(18)15-11(13)17;/h2,4,6,9H,1,3,5,7-8H2,(H2,14,15,16,17,18); |
| InChIKey | NSKPEJVJPVMVNN-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze CID 131986407 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 131986407?
The IUPAC name of CID 131986407 (CID 131986407) is not available.
What is the SMILES notation for CID 131986407?
The canonical SMILES for CID 131986407 is C=CCC1(C2C=CCCC2)C(=O)NC(=S)NC1=O.[Na].
What is the InChIKey of CID 131986407?
The InChIKey is NSKPEJVJPVMVNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O2S.Na/c1-2-8-13(9-6-4-3-5-7-9)10(16)14-12(18)15-11(13)17;/h2,4,6,9H,1,3,5,7-8H2,(H2,14,15,16,17,18);.
What are the key properties of CID 131986407?
CID 131986407 has a molecular weight of 287.34 g/mol, XLogP of 1.06, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 131986407 is sourced from PubChem (CID 131986407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).