C27H36FN3O3 — CID 131986450
(3S)-4-[(3S)-3-fluoro-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]-3-[3-(2-methoxyethyl)phenyl]butanoic acid (PubChem CID 131986450) has the molecular formula C27H36FN3O3 and a molecular weight of 469.60 g/mol. Its IUPAC name is (3S)-4-[(3S)-3-fluoro-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]-3-[3-(2-methoxyethyl)phenyl]butanoic acid.
| Compound Name | (3S)-4-[(3S)-3-fluoro-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]-3-[3-(2-methoxyethyl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 131986450 |
| Molecular Formula | C27H36FN3O3 |
| Molecular Weight | 469.60 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | (3S)-4-[(3S)-3-fluoro-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]-3-[3-(2-methoxyethyl)phenyl]butanoic acid |
| SMILES | COCCc1cccc([C@H](CC(=O)O)CN2CC[C@@](F)(CCc3ccc4c(n3)NCCC4)C2)c1 |
| InChI | InChI=1S/C27H36FN3O3/c1-34-15-10-20-4-2-5-22(16-20)23(17-25(32)33)18-31-14-12-27(28,19-31)11-9-24-8-7-21-6-3-13-29-26(21)30-24/h2,4-5,7-8,16,23H,3,6,9-15,17-19H2,1H3,(H,29,30)(H,32,33)/t23-,27+/m1/s1 |
| InChIKey | WRXLVNUCQDZZSY-KCWPFWIISA-N |
| XLogP | 4.23 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.60 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |