C18H20N6O2 — CID 131986654
2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-1-prop-2-enylbenzimidazole-5-carboxamide (PubChem CID 131986654) has the molecular formula C18H20N6O2 and a molecular weight of 352.40 g/mol. Its IUPAC name is 2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-1-prop-2-enylbenzimidazole-5-carboxamide.
| Compound Name | 2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-1-prop-2-enylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 131986654 |
| Molecular Formula | C18H20N6O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-1-prop-2-enylbenzimidazole-5-carboxamide |
| SMILES | C=CCn1c(NC(=O)c2cc(C)nn2CC)nc2cc(C(N)=O)ccc21 |
| InChI | InChI=1S/C18H20N6O2/c1-4-8-23-14-7-6-12(16(19)25)10-13(14)20-18(23)21-17(26)15-9-11(3)22-24(15)5-2/h4,6-7,9-10H,1,5,8H2,2-3H3,(H2,19,25)(H,20,21,26) |
| InChIKey | DSIGRSCTTIAQMG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 107.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|