About CID 131986712
CID 131986712 (PubChem CID 131986712) has the molecular formula C15H12FN3NaO3
and a molecular weight of 324.27 g/mol.
Molecular Properties
| Compound Name | CID 131986712 |
| PubChem CID | 131986712 |
| Molecular Formula | C15H12FN3NaO3 |
| Molecular Weight | 324.27 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | — |
| SMILES | COCc1cc(-c2cccc(F)c2)nc2c(C(=O)O)cnn12.[Na] |
| InChI | InChI=1S/C15H12FN3O3.Na/c1-22-8-11-6-13(9-3-2-4-10(16)5-9)18-14-12(15(20)21)7-17-19(11)14;/h2-7H,8H2,1H3,(H,20,21); |
| InChIKey | JZMSPEVTBLLUSY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 131986712 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 131986712?
The IUPAC name of CID 131986712 (CID 131986712) is not available.
What is the SMILES notation for CID 131986712?
The canonical SMILES for CID 131986712 is COCc1cc(-c2cccc(F)c2)nc2c(C(=O)O)cnn12.[Na].
What is the InChIKey of CID 131986712?
The InChIKey is JZMSPEVTBLLUSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12FN3O3.Na/c1-22-8-11-6-13(9-3-2-4-10(16)5-9)18-14-12(15(20)21)7-17-19(11)14;/h2-7H,8H2,1H3,(H,20,21);.
What are the key properties of CID 131986712?
CID 131986712 has a molecular weight of 324.27 g/mol, XLogP of 2.00, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 131986712 is sourced from PubChem (CID 131986712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).