C21H24N2O4 — CID 131987129
(2R,3S)-5-N-(2-methoxyethyl)-7-N,2-dimethyl-3-phenyl-2,3-dihydro-1-benzofuran-5,7-dicarboxamide (PubChem CID 131987129) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is (2R,3S)-5-N-(2-methoxyethyl)-7-N,2-dimethyl-3-phenyl-2,3-dihydro-1-benzofuran-5,7-dicarboxamide.
| Compound Name | (2R,3S)-5-N-(2-methoxyethyl)-7-N,2-dimethyl-3-phenyl-2,3-dihydro-1-benzofuran-5,7-dicarboxamide |
|---|---|
| PubChem CID | 131987129 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | (2R,3S)-5-N-(2-methoxyethyl)-7-N,2-dimethyl-3-phenyl-2,3-dihydro-1-benzofuran-5,7-dicarboxamide |
| SMILES | CNC(=O)c1cc(C(=O)NCCOC)cc2c1O[C@H](C)[C@H]2c1ccccc1 |
| InChI | InChI=1S/C21H24N2O4/c1-13-18(14-7-5-4-6-8-14)16-11-15(20(24)23-9-10-26-3)12-17(19(16)27-13)21(25)22-2/h4-8,11-13,18H,9-10H2,1-3H3,(H,22,25)(H,23,24)/t13-,18+/m1/s1 |
| InChIKey | GZJPFVGFRGYSAO-ACJLOTCBSA-N |
| XLogP | 2.34 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|