C18H18BrNO4 — CID 131987138
5-bromo-2-hydroxy-3-[(3-methoxyphenyl)-(oxiran-2-yl)methyl]-N-methylbenzamide (PubChem CID 131987138) has the molecular formula C18H18BrNO4 and a molecular weight of 392.25 g/mol. Its IUPAC name is 5-bromo-2-hydroxy-3-[(3-methoxyphenyl)-(oxiran-2-yl)methyl]-N-methylbenzamide.
| Compound Name | 5-bromo-2-hydroxy-3-[(3-methoxyphenyl)-(oxiran-2-yl)methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 131987138 |
| Molecular Formula | C18H18BrNO4 |
| Molecular Weight | 392.25 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | 5-bromo-2-hydroxy-3-[(3-methoxyphenyl)-(oxiran-2-yl)methyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1cc(Br)cc(C(c2cccc(OC)c2)C2CO2)c1O |
| InChI | InChI=1S/C18H18BrNO4/c1-20-18(22)14-8-11(19)7-13(17(14)21)16(15-9-24-15)10-4-3-5-12(6-10)23-2/h3-8,15-16,21H,9H2,1-2H3,(H,20,22) |
| InChIKey | LEWMWEOUIMFIRQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.25 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|