3-(2-aminoethyl)-3-fluoropiperidine-1-carboxylic acid

C8H15FN2O2 — CID 131987270

IUPAC3-(2-aminoethyl)-3-fluoropiperidine-1-carboxylic acid
SMILESNCCC1(F)CCCN(C(=O)O)C1
InChIInChI=1S/C8H15FN2O2/c9-8(3-4-10)2-1-5-11(6-8)7(12)13/h1-6,10H2,(H,12,13)
InChIKeyNBORHLCPNOGYLH-UHFFFAOYSA-N
MW190.22 g/mol
LogP0.82
Rot. Bonds2

About 3-(2-aminoethyl)-3-fluoropiperidine-1-carboxylic acid

3-(2-aminoethyl)-3-fluoropiperidine-1-carboxylic acid (PubChem CID 131987270) has the molecular formula C8H15FN2O2 and a molecular weight of 190.22 g/mol. Its IUPAC name is 3-(2-aminoethyl)-3-fluoropiperidine-1-carboxylic acid.

Molecular Properties

Compound Name3-(2-aminoethyl)-3-fluoropiperidine-1-carboxylic acid
PubChem CID131987270
Molecular FormulaC8H15FN2O2
Molecular Weight190.22 g/mol
Exact Mass190.11
IUPAC Name3-(2-aminoethyl)-3-fluoropiperidine-1-carboxylic acid
SMILESNCCC1(F)CCCN(C(=O)O)C1
InChIInChI=1S/C8H15FN2O2/c9-8(3-4-10)2-1-5-11(6-8)7(12)13/h1-6,10H2,(H,12,13)
InChIKeyNBORHLCPNOGYLH-UHFFFAOYSA-N
XLogP0.82
TPSA66.56 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.22
LogP ≤ 50.82
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-(2-aminoethyl)-3-fluoropiperidine-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2-aminoethyl)-3-fluoropiperidine-1-carboxylic acid?
The IUPAC name of 3-(2-aminoethyl)-3-fluoropiperidine-1-carboxylic acid (CID 131987270) is 3-(2-aminoethyl)-3-fluoropiperidine-1-carboxylic acid.
What is the SMILES notation for 3-(2-aminoethyl)-3-fluoropiperidine-1-carboxylic acid?
The canonical SMILES for 3-(2-aminoethyl)-3-fluoropiperidine-1-carboxylic acid is NCCC1(F)CCCN(C(=O)O)C1.
What is the InChIKey of 3-(2-aminoethyl)-3-fluoropiperidine-1-carboxylic acid?
The InChIKey is NBORHLCPNOGYLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15FN2O2/c9-8(3-4-10)2-1-5-11(6-8)7(12)13/h1-6,10H2,(H,12,13).
What are the key properties of 3-(2-aminoethyl)-3-fluoropiperidine-1-carboxylic acid?
3-(2-aminoethyl)-3-fluoropiperidine-1-carboxylic acid has a molecular weight of 190.22 g/mol, XLogP of 0.82, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-aminoethyl)-3-fluoropiperidine-1-carboxylic acid is sourced from PubChem (CID 131987270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).