About (E)-1,2-bis(methylsulfonyl)ethene
(E)-1,2-bis(methylsulfonyl)ethene (PubChem CID 13198777) has the molecular formula C4H8O4S2
and a molecular weight of 184.24 g/mol. Its IUPAC name is (E)-1,2-bis(methylsulfonyl)ethene.
Molecular Properties
| Compound Name | (E)-1,2-bis(methylsulfonyl)ethene |
| PubChem CID | 13198777 |
| Molecular Formula | C4H8O4S2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 183.99 |
| IUPAC Name | (E)-1,2-bis(methylsulfonyl)ethene |
| SMILES | CS(=O)(=O)/C=C/S(C)(=O)=O |
| InChI | InChI=1S/C4H8O4S2/c1-9(5,6)3-4-10(2,7)8/h3-4H,1-2H3/b4-3+ |
| InChIKey | IRLNDARFTZAVFE-ONEGZZNKSA-N |
| XLogP | -0.45 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (E)-1,2-bis(methylsulfonyl)ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,2-bis(methylsulfonyl)ethene?
The IUPAC name of (E)-1,2-bis(methylsulfonyl)ethene (CID 13198777) is (E)-1,2-bis(methylsulfonyl)ethene.
What is the SMILES notation for (E)-1,2-bis(methylsulfonyl)ethene?
The canonical SMILES for (E)-1,2-bis(methylsulfonyl)ethene is CS(=O)(=O)/C=C/S(C)(=O)=O.
What is the InChIKey of (E)-1,2-bis(methylsulfonyl)ethene?
The InChIKey is IRLNDARFTZAVFE-ONEGZZNKSA-N. The full InChI is InChI=1S/C4H8O4S2/c1-9(5,6)3-4-10(2,7)8/h3-4H,1-2H3/b4-3+.
What are the key properties of (E)-1,2-bis(methylsulfonyl)ethene?
(E)-1,2-bis(methylsulfonyl)ethene has a molecular weight of 184.24 g/mol, XLogP of -0.45, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,2-bis(methylsulfonyl)ethene is sourced from PubChem (CID 13198777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).