C24H27FN2O4 — CID 131988576
5-[(6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carbonyl)-(3-phenylpropyl)amino]pentanoic acid (PubChem CID 131988576) has the molecular formula C24H27FN2O4 and a molecular weight of 426.49 g/mol. Its IUPAC name is 5-[(6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carbonyl)-(3-phenylpropyl)amino]pentanoic acid.
| Compound Name | 5-[(6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carbonyl)-(3-phenylpropyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 131988576 |
| Molecular Formula | C24H27FN2O4 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 5-[(6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carbonyl)-(3-phenylpropyl)amino]pentanoic acid |
| SMILES | O=C(O)CCCCN(CCCc1ccccc1)C(=O)C1CC(=O)Nc2ccc(F)cc21 |
| InChI | InChI=1S/C24H27FN2O4/c25-18-11-12-21-19(15-18)20(16-22(28)26-21)24(31)27(13-5-4-10-23(29)30)14-6-9-17-7-2-1-3-8-17/h1-3,7-8,11-12,15,20H,4-6,9-10,13-14,16H2,(H,26,28)(H,29,30) |
| InChIKey | CTWSLAFSMGNJSI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|