C18H17N3O5 — CID 131988625
2-(2,6-dioxopiperidin-3-yl)-4-(2-prop-2-ynoxyethylamino)isoindole-1,3-dione (PubChem CID 131988625) has the molecular formula C18H17N3O5 and a molecular weight of 355.35 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-(2-prop-2-ynoxyethylamino)isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-(2-prop-2-ynoxyethylamino)isoindole-1,3-dione |
|---|---|
| PubChem CID | 131988625 |
| Molecular Formula | C18H17N3O5 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-(2-prop-2-ynoxyethylamino)isoindole-1,3-dione |
| SMILES | C#CCOCCNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C18H17N3O5/c1-2-9-26-10-8-19-12-5-3-4-11-15(12)18(25)21(17(11)24)13-6-7-14(22)20-16(13)23/h1,3-5,13,19H,6-10H2,(H,20,22,23) |
| InChIKey | MJZIEGLWFMWPGN-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|