About 5-[4-[2-[(4-bromo-1,3-thiazol-2-yl)oxy]ethyl]-3-propan-2-ylpiperidin-4-yl]oxadiazole
5-[4-[2-[(4-bromo-1,3-thiazol-2-yl)oxy]ethyl]-3-propan-2-ylpiperidin-4-yl]oxadiazole (PubChem CID 131988751) has the molecular formula C15H21BrN4O2S
and a molecular weight of 401.33 g/mol. Its IUPAC name is 5-[4-[2-[(4-bromo-1,3-thiazol-2-yl)oxy]ethyl]-3-propan-2-ylpiperidin-4-yl]oxadiazole.
Molecular Properties
| Compound Name | 5-[4-[2-[(4-bromo-1,3-thiazol-2-yl)oxy]ethyl]-3-propan-2-ylpiperidin-4-yl]oxadiazole |
| PubChem CID | 131988751 |
| Molecular Formula | C15H21BrN4O2S |
| Molecular Weight | 401.33 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 5-[4-[2-[(4-bromo-1,3-thiazol-2-yl)oxy]ethyl]-3-propan-2-ylpiperidin-4-yl]oxadiazole |
| SMILES | CC(C)C1CNCCC1(CCOc1nc(Br)cs1)c1cnno1 |
| InChI | InChI=1S/C15H21BrN4O2S/c1-10(2)11-7-17-5-3-15(11,12-8-18-20-22-12)4-6-21-14-19-13(16)9-23-14/h8-11,17H,3-7H2,1-2H3 |
| InChIKey | YXCBVMSDFXTHQP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[4-[2-[(4-bromo-1,3-thiazol-2-yl)oxy]ethyl]-3-propan-2-ylpiperidin-4-yl]oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-[2-[(4-bromo-1,3-thiazol-2-yl)oxy]ethyl]-3-propan-2-ylpiperidin-4-yl]oxadiazole?
The IUPAC name of 5-[4-[2-[(4-bromo-1,3-thiazol-2-yl)oxy]ethyl]-3-propan-2-ylpiperidin-4-yl]oxadiazole (CID 131988751) is 5-[4-[2-[(4-bromo-1,3-thiazol-2-yl)oxy]ethyl]-3-propan-2-ylpiperidin-4-yl]oxadiazole.
What is the SMILES notation for 5-[4-[2-[(4-bromo-1,3-thiazol-2-yl)oxy]ethyl]-3-propan-2-ylpiperidin-4-yl]oxadiazole?
The canonical SMILES for 5-[4-[2-[(4-bromo-1,3-thiazol-2-yl)oxy]ethyl]-3-propan-2-ylpiperidin-4-yl]oxadiazole is CC(C)C1CNCCC1(CCOc1nc(Br)cs1)c1cnno1.
What is the InChIKey of 5-[4-[2-[(4-bromo-1,3-thiazol-2-yl)oxy]ethyl]-3-propan-2-ylpiperidin-4-yl]oxadiazole?
The InChIKey is YXCBVMSDFXTHQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21BrN4O2S/c1-10(2)11-7-17-5-3-15(11,12-8-18-20-22-12)4-6-21-14-19-13(16)9-23-14/h8-11,17H,3-7H2,1-2H3.
What are the key properties of 5-[4-[2-[(4-bromo-1,3-thiazol-2-yl)oxy]ethyl]-3-propan-2-ylpiperidin-4-yl]oxadiazole?
5-[4-[2-[(4-bromo-1,3-thiazol-2-yl)oxy]ethyl]-3-propan-2-ylpiperidin-4-yl]oxadiazole has a molecular weight of 401.33 g/mol, XLogP of 3.26, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-[2-[(4-bromo-1,3-thiazol-2-yl)oxy]ethyl]-3-propan-2-ylpiperidin-4-yl]oxadiazole is sourced from PubChem (CID 131988751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).