C20H24ClN9OS — CID 131989212
N-(2-chloro-6-methylphenyl)-2-[[2-hydrazinyl-6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide (PubChem CID 131989212) has the molecular formula C20H24ClN9OS and a molecular weight of 473.99 g/mol. Its IUPAC name is N-(2-chloro-6-methylphenyl)-2-[[2-hydrazinyl-6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide.
| Compound Name | N-(2-chloro-6-methylphenyl)-2-[[2-hydrazinyl-6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 131989212 |
| Molecular Formula | C20H24ClN9OS |
| Molecular Weight | 473.99 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-2-[[2-hydrazinyl-6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1cccc(Cl)c1NC(=O)c1cnc(Nc2cc(N3CCN(C)CC3)nc(NN)n2)s1 |
| InChI | InChI=1S/C20H24ClN9OS/c1-12-4-3-5-13(21)17(12)27-18(31)14-11-23-20(32-14)25-15-10-16(26-19(24-15)28-22)30-8-6-29(2)7-9-30/h3-5,10-11H,6-9,22H2,1-2H3,(H,27,31)(H2,23,24,25,26,28) |
| InChIKey | YERAJHOKKHKILV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 124.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.99 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|