C19H23N11O3S — CID 131989284
2-[[4-[4-[(3-oxocyclopenten-1-yl)amino]piperazin-1-yl]-6-(2-prop-2-enoylhydrazinyl)-1,3,5-triazin-2-yl]amino]-1,3-thiazole-5-carboxamide (PubChem CID 131989284) has the molecular formula C19H23N11O3S and a molecular weight of 485.53 g/mol. Its IUPAC name is 2-[[4-[4-[(3-oxocyclopenten-1-yl)amino]piperazin-1-yl]-6-(2-prop-2-enoylhydrazinyl)-1,3,5-triazin-2-yl]amino]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[[4-[4-[(3-oxocyclopenten-1-yl)amino]piperazin-1-yl]-6-(2-prop-2-enoylhydrazinyl)-1,3,5-triazin-2-yl]amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 131989284 |
| Molecular Formula | C19H23N11O3S |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | 2-[[4-[4-[(3-oxocyclopenten-1-yl)amino]piperazin-1-yl]-6-(2-prop-2-enoylhydrazinyl)-1,3,5-triazin-2-yl]amino]-1,3-thiazole-5-carboxamide |
| SMILES | C=CC(=O)NNc1nc(Nc2ncc(C(N)=O)s2)nc(N2CCN(NC3=CC(=O)CC3)CC2)n1 |
| InChI | InChI=1S/C19H23N11O3S/c1-2-14(32)26-27-17-22-16(25-19-21-10-13(34-19)15(20)33)23-18(24-17)29-5-7-30(8-6-29)28-11-3-4-12(31)9-11/h2,9-10,28H,1,3-8H2,(H2,20,33)(H,26,32)(H2,21,22,23,24,25,27) |
| InChIKey | QHISKZRKVPUXTR-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 183.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|