C19H30O3 — CID 131989581
(Z)-4-(3-butyl-1,2,6,6-tetramethyl-4-oxocyclohex-2-en-1-yl)oxy-3-methylbut-2-enal (PubChem CID 131989581) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is (Z)-4-(3-butyl-1,2,6,6-tetramethyl-4-oxocyclohex-2-en-1-yl)oxy-3-methylbut-2-enal.
| Compound Name | (Z)-4-(3-butyl-1,2,6,6-tetramethyl-4-oxocyclohex-2-en-1-yl)oxy-3-methylbut-2-enal |
|---|---|
| PubChem CID | 131989581 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | (Z)-4-(3-butyl-1,2,6,6-tetramethyl-4-oxocyclohex-2-en-1-yl)oxy-3-methylbut-2-enal |
| SMILES | CCCCC1=C(C)C(C)(OC/C(C)=C\C=O)C(C)(C)CC1=O |
| InChI | InChI=1S/C19H30O3/c1-7-8-9-16-15(3)19(6,18(4,5)12-17(16)21)22-13-14(2)10-11-20/h10-11H,7-9,12-13H2,1-6H3/b14-10- |
| InChIKey | ONKNZFNURJBLRC-UVTDQMKNSA-N |
| XLogP | 4.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|