C28H47N5O2 — CID 131989790
1-(6-butyl-3,3-dimethyl-5-methylidene-2H-pyrrolo[2,3-c]pyridin-1-yl)-2-[(2R,5R)-2-[[(3R,5R)-3,5-dimethylmorpholin-4-yl]methyl]-5-methylpiperazin-1-yl]ethanone (PubChem CID 131989790) has the molecular formula C28H47N5O2 and a molecular weight of 485.72 g/mol. Its IUPAC name is 1-(6-butyl-3,3-dimethyl-5-methylidene-2H-pyrrolo[2,3-c]pyridin-1-yl)-2-[(2R,5R)-2-[[(3R,5R)-3,5-dimethylmorpholin-4-yl]methyl]-5-methylpiperazin-1-yl]ethanone.
| Compound Name | 1-(6-butyl-3,3-dimethyl-5-methylidene-2H-pyrrolo[2,3-c]pyridin-1-yl)-2-[(2R,5R)-2-[[(3R,5R)-3,5-dimethylmorpholin-4-yl]methyl]-5-methylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 131989790 |
| Molecular Formula | C28H47N5O2 |
| Molecular Weight | 485.72 g/mol |
| Exact Mass | 485.37 |
| IUPAC Name | 1-(6-butyl-3,3-dimethyl-5-methylidene-2H-pyrrolo[2,3-c]pyridin-1-yl)-2-[(2R,5R)-2-[[(3R,5R)-3,5-dimethylmorpholin-4-yl]methyl]-5-methylpiperazin-1-yl]ethanone |
| SMILES | C=C1C=C2C(=CN1CCCC)N(C(=O)CN1C[C@@H](C)NC[C@@H]1CN1[C@H](C)COC[C@H]1C)CC2(C)C |
| InChI | InChI=1S/C28H47N5O2/c1-8-9-10-30-15-26-25(11-21(30)3)28(6,7)19-33(26)27(34)16-31-13-20(2)29-12-24(31)14-32-22(4)17-35-18-23(32)5/h11,15,20,22-24,29H,3,8-10,12-14,16-19H2,1-2,4-7H3/t20-,22-,23-,24-/m1/s1 |
| InChIKey | SXCXCSLMTXFYFJ-MSNJVRRCSA-N |
| XLogP | 3.02 |
| TPSA | 51.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.72 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |