About (3-nitrophenyl)methyl 2-[(3,4-dichlorophenyl)sulfonylamino]acetate
(3-nitrophenyl)methyl 2-[(3,4-dichlorophenyl)sulfonylamino]acetate (PubChem CID 1319900) has the molecular formula C15H12Cl2N2O6S
and a molecular weight of 419.24 g/mol. Its IUPAC name is (3-nitrophenyl)methyl 2-[(3,4-dichlorophenyl)sulfonylamino]acetate.
Molecular Properties
| Compound Name | (3-nitrophenyl)methyl 2-[(3,4-dichlorophenyl)sulfonylamino]acetate |
| PubChem CID | 1319900 |
| Molecular Formula | C15H12Cl2N2O6S |
| Molecular Weight | 419.24 g/mol |
| Exact Mass | 417.98 |
| IUPAC Name | (3-nitrophenyl)methyl 2-[(3,4-dichlorophenyl)sulfonylamino]acetate |
| SMILES | O=C(CNS(=O)(=O)c1ccc(Cl)c(Cl)c1)OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H12Cl2N2O6S/c16-13-5-4-12(7-14(13)17)26(23,24)18-8-15(20)25-9-10-2-1-3-11(6-10)19(21)22/h1-7,18H,8-9H2 |
| InChIKey | HZMUUEZBKSGKQC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.24 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3-nitrophenyl)methyl 2-[(3,4-dichlorophenyl)sulfonylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-nitrophenyl)methyl 2-[(3,4-dichlorophenyl)sulfonylamino]acetate?
The IUPAC name of (3-nitrophenyl)methyl 2-[(3,4-dichlorophenyl)sulfonylamino]acetate (CID 1319900) is (3-nitrophenyl)methyl 2-[(3,4-dichlorophenyl)sulfonylamino]acetate.
What is the SMILES notation for (3-nitrophenyl)methyl 2-[(3,4-dichlorophenyl)sulfonylamino]acetate?
The canonical SMILES for (3-nitrophenyl)methyl 2-[(3,4-dichlorophenyl)sulfonylamino]acetate is O=C(CNS(=O)(=O)c1ccc(Cl)c(Cl)c1)OCc1cccc([N+](=O)[O-])c1.
What is the InChIKey of (3-nitrophenyl)methyl 2-[(3,4-dichlorophenyl)sulfonylamino]acetate?
The InChIKey is HZMUUEZBKSGKQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12Cl2N2O6S/c16-13-5-4-12(7-14(13)17)26(23,24)18-8-15(20)25-9-10-2-1-3-11(6-10)19(21)22/h1-7,18H,8-9H2.
What are the key properties of (3-nitrophenyl)methyl 2-[(3,4-dichlorophenyl)sulfonylamino]acetate?
(3-nitrophenyl)methyl 2-[(3,4-dichlorophenyl)sulfonylamino]acetate has a molecular weight of 419.24 g/mol, XLogP of 2.92, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-nitrophenyl)methyl 2-[(3,4-dichlorophenyl)sulfonylamino]acetate is sourced from PubChem (CID 1319900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).