C33H37F5N2O5 — CID 131990437
3-[(3R,4S)-1-[(3R,6S)-6-cyclopropyl-6-[8-(1,1-difluoroethyl)-6-(trifluoromethyl)-2,4-dihydro-1,3-benzoxazine-3-carbonyl]oxan-3-yl]-3-methylpiperidin-4-yl]benzoic acid (PubChem CID 131990437) has the molecular formula C33H37F5N2O5 and a molecular weight of 636.66 g/mol. Its IUPAC name is 3-[(3R,4S)-1-[(3R,6S)-6-cyclopropyl-6-[8-(1,1-difluoroethyl)-6-(trifluoromethyl)-2,4-dihydro-1,3-benzoxazine-3-carbonyl]oxan-3-yl]-3-methylpiperidin-4-yl]benzoic acid.
| Compound Name | 3-[(3R,4S)-1-[(3R,6S)-6-cyclopropyl-6-[8-(1,1-difluoroethyl)-6-(trifluoromethyl)-2,4-dihydro-1,3-benzoxazine-3-carbonyl]oxan-3-yl]-3-methylpiperidin-4-yl]benzoic acid |
|---|---|
| PubChem CID | 131990437 |
| Molecular Formula | C33H37F5N2O5 |
| Molecular Weight | 636.66 g/mol |
| Exact Mass | 636.26 |
| IUPAC Name | 3-[(3R,4S)-1-[(3R,6S)-6-cyclopropyl-6-[8-(1,1-difluoroethyl)-6-(trifluoromethyl)-2,4-dihydro-1,3-benzoxazine-3-carbonyl]oxan-3-yl]-3-methylpiperidin-4-yl]benzoic acid |
| SMILES | C[C@H]1CN([C@@H]2CC[C@@](C(=O)N3COc4c(cc(C(F)(F)F)cc4C(C)(F)F)C3)(C3CC3)OC2)CC[C@@H]1c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C33H37F5N2O5/c1-19-15-39(11-9-26(19)20-4-3-5-21(12-20)29(41)42)25-8-10-32(45-17-25,23-6-7-23)30(43)40-16-22-13-24(33(36,37)38)14-27(31(2,34)35)28(22)44-18-40/h3-5,12-14,19,23,25-26H,6-11,15-18H2,1-2H3,(H,41,42)/t19-,25+,26-,32-/m0/s1 |
| InChIKey | QCANRWBMNMBKSH-BJWBRBSJSA-N |
| XLogP | 6.65 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.66 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |