About 4-propan-2-ylpyrido[1,2-b]pyridazine
4-propan-2-ylpyrido[1,2-b]pyridazine (PubChem CID 131990524) has the molecular formula C11H12N2
and a molecular weight of 172.23 g/mol. Its IUPAC name is 4-propan-2-ylpyrido[1,2-b]pyridazine.
Molecular Properties
| Compound Name | 4-propan-2-ylpyrido[1,2-b]pyridazine |
| PubChem CID | 131990524 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 4-propan-2-ylpyrido[1,2-b]pyridazine |
| SMILES | CC(C)C1=C2C=CC=CN2N=C=C1 |
| InChI | InChI=1S/C11H12N2/c1-9(2)10-6-7-12-13-8-4-3-5-11(10)13/h3-6,8-9H,1-2H3 |
| InChIKey | AEHFYQRYHQJGDF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-propan-2-ylpyrido[1,2-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-ylpyrido[1,2-b]pyridazine?
The IUPAC name of 4-propan-2-ylpyrido[1,2-b]pyridazine (CID 131990524) is 4-propan-2-ylpyrido[1,2-b]pyridazine.
What is the SMILES notation for 4-propan-2-ylpyrido[1,2-b]pyridazine?
The canonical SMILES for 4-propan-2-ylpyrido[1,2-b]pyridazine is CC(C)C1=C2C=CC=CN2N=C=C1.
What is the InChIKey of 4-propan-2-ylpyrido[1,2-b]pyridazine?
The InChIKey is AEHFYQRYHQJGDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2/c1-9(2)10-6-7-12-13-8-4-3-5-11(10)13/h3-6,8-9H,1-2H3.
What are the key properties of 4-propan-2-ylpyrido[1,2-b]pyridazine?
4-propan-2-ylpyrido[1,2-b]pyridazine has a molecular weight of 172.23 g/mol, XLogP of 2.44, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-ylpyrido[1,2-b]pyridazine is sourced from PubChem (CID 131990524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).