C10H15NO2 — CID 131990761
(3Z,5E)-6-methyl-8-(methylamino)octa-3,5-dien-1-yne-3,4-diol (PubChem CID 131990761) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is (3Z,5E)-6-methyl-8-(methylamino)octa-3,5-dien-1-yne-3,4-diol.
| Compound Name | (3Z,5E)-6-methyl-8-(methylamino)octa-3,5-dien-1-yne-3,4-diol |
|---|---|
| PubChem CID | 131990761 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | (3Z,5E)-6-methyl-8-(methylamino)octa-3,5-dien-1-yne-3,4-diol |
| SMILES | C#C/C(O)=C(O)\C=C(/C)CCNC |
| InChI | InChI=1S/C10H15NO2/c1-4-9(12)10(13)7-8(2)5-6-11-3/h1,7,11-13H,5-6H2,2-3H3/b8-7+,10-9- |
| InChIKey | ZOLMWGKXQOIMCI-GOJKSUSPSA-N |
| XLogP | 1.50 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|