About 3-(3-tert-butylcyclopentyl)-1-cyclopentyl-2,2-dimethylpropan-1-one
3-(3-tert-butylcyclopentyl)-1-cyclopentyl-2,2-dimethylpropan-1-one (PubChem CID 131991055) has the molecular formula C19H34O
and a molecular weight of 278.48 g/mol. Its IUPAC name is 3-(3-tert-butylcyclopentyl)-1-cyclopentyl-2,2-dimethylpropan-1-one.
Molecular Properties
| Compound Name | 3-(3-tert-butylcyclopentyl)-1-cyclopentyl-2,2-dimethylpropan-1-one |
| PubChem CID | 131991055 |
| Molecular Formula | C19H34O |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.26 |
| IUPAC Name | 3-(3-tert-butylcyclopentyl)-1-cyclopentyl-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(CC1CCC(C(C)(C)C)C1)C(=O)C1CCCC1 |
| InChI | InChI=1S/C19H34O/c1-18(2,3)16-11-10-14(12-16)13-19(4,5)17(20)15-8-6-7-9-15/h14-16H,6-13H2,1-5H3 |
| InChIKey | YOMSUZOROHQSCV-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(3-tert-butylcyclopentyl)-1-cyclopentyl-2,2-dimethylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-tert-butylcyclopentyl)-1-cyclopentyl-2,2-dimethylpropan-1-one?
The IUPAC name of 3-(3-tert-butylcyclopentyl)-1-cyclopentyl-2,2-dimethylpropan-1-one (CID 131991055) is 3-(3-tert-butylcyclopentyl)-1-cyclopentyl-2,2-dimethylpropan-1-one.
What is the SMILES notation for 3-(3-tert-butylcyclopentyl)-1-cyclopentyl-2,2-dimethylpropan-1-one?
The canonical SMILES for 3-(3-tert-butylcyclopentyl)-1-cyclopentyl-2,2-dimethylpropan-1-one is CC(C)(CC1CCC(C(C)(C)C)C1)C(=O)C1CCCC1.
What is the InChIKey of 3-(3-tert-butylcyclopentyl)-1-cyclopentyl-2,2-dimethylpropan-1-one?
The InChIKey is YOMSUZOROHQSCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H34O/c1-18(2,3)16-11-10-14(12-16)13-19(4,5)17(20)15-8-6-7-9-15/h14-16H,6-13H2,1-5H3.
What are the key properties of 3-(3-tert-butylcyclopentyl)-1-cyclopentyl-2,2-dimethylpropan-1-one?
3-(3-tert-butylcyclopentyl)-1-cyclopentyl-2,2-dimethylpropan-1-one has a molecular weight of 278.48 g/mol, XLogP of 5.62, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-tert-butylcyclopentyl)-1-cyclopentyl-2,2-dimethylpropan-1-one is sourced from PubChem (CID 131991055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).