C14H24N2 — CID 131991312
N-[(3Z,5E)-2,2-dimethyl-6-(1-methylazetidin-3-yl)hepta-3,5-dien-3-yl]methanimine (PubChem CID 131991312) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is N-[(3Z,5E)-2,2-dimethyl-6-(1-methylazetidin-3-yl)hepta-3,5-dien-3-yl]methanimine.
| Compound Name | N-[(3Z,5E)-2,2-dimethyl-6-(1-methylazetidin-3-yl)hepta-3,5-dien-3-yl]methanimine |
|---|---|
| PubChem CID | 131991312 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | N-[(3Z,5E)-2,2-dimethyl-6-(1-methylazetidin-3-yl)hepta-3,5-dien-3-yl]methanimine |
| SMILES | C=N/C(=C\C=C(/C)C1CN(C)C1)C(C)(C)C |
| InChI | InChI=1S/C14H24N2/c1-11(12-9-16(6)10-12)7-8-13(15-5)14(2,3)4/h7-8,12H,5,9-10H2,1-4,6H3/b11-7+,13-8- |
| InChIKey | ZPWOGGIUIBFFKM-NVGJIZNYSA-N |
| XLogP | 3.12 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|