C22H29N3O4S — CID 131991440
2-formyl-N-[(2R,3S,4S)-4-methanethioyl-5,5-dimethyl-8-oxo-2-pentyl-7-oxa-1,9-diazaspiro[2.6]nonan-1-yl]benzamide (PubChem CID 131991440) has the molecular formula C22H29N3O4S and a molecular weight of 431.56 g/mol. Its IUPAC name is 2-formyl-N-[(2R,3S,4S)-4-methanethioyl-5,5-dimethyl-8-oxo-2-pentyl-7-oxa-1,9-diazaspiro[2.6]nonan-1-yl]benzamide.
| Compound Name | 2-formyl-N-[(2R,3S,4S)-4-methanethioyl-5,5-dimethyl-8-oxo-2-pentyl-7-oxa-1,9-diazaspiro[2.6]nonan-1-yl]benzamide |
|---|---|
| PubChem CID | 131991440 |
| Molecular Formula | C22H29N3O4S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 2-formyl-N-[(2R,3S,4S)-4-methanethioyl-5,5-dimethyl-8-oxo-2-pentyl-7-oxa-1,9-diazaspiro[2.6]nonan-1-yl]benzamide |
| SMILES | CCCCC[C@H]1N(NC(=O)c2ccccc2C=O)[C@]12NC(=O)OCC(C)(C)[C@@H]2C=S |
| InChI | InChI=1S/C22H29N3O4S/c1-4-5-6-11-18-22(17(13-30)21(2,3)14-29-20(28)23-22)25(18)24-19(27)16-10-8-7-9-15(16)12-26/h7-10,12-13,17-18H,4-6,11,14H2,1-3H3,(H,23,28)(H,24,27)/t17-,18+,22-,25?/m0/s1 |
| InChIKey | JLAGSFSTEMMQRR-NRILOXMTSA-N |
| XLogP | 3.49 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|