C30H35N7O4S — CID 131991795
N-[3-[[4-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]benzoyl]amino]propyl]-3-phenyl-1H-pyrazole-5-carboxamide (PubChem CID 131991795) has the molecular formula C30H35N7O4S and a molecular weight of 589.72 g/mol. Its IUPAC name is N-[3-[[4-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]benzoyl]amino]propyl]-3-phenyl-1H-pyrazole-5-carboxamide.
| Compound Name | N-[3-[[4-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]benzoyl]amino]propyl]-3-phenyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 131991795 |
| Molecular Formula | C30H35N7O4S |
| Molecular Weight | 589.72 g/mol |
| Exact Mass | 589.25 |
| IUPAC Name | N-[3-[[4-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]benzoyl]amino]propyl]-3-phenyl-1H-pyrazole-5-carboxamide |
| SMILES | O=C(CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21)Nc1ccc(C(=O)NCCCNC(=O)c2cc(-c3ccccc3)n[nH]2)cc1 |
| InChI | InChI=1S/C30H35N7O4S/c38-26(10-5-4-9-25-27-24(18-42-25)34-30(41)35-27)33-21-13-11-20(12-14-21)28(39)31-15-6-16-32-29(40)23-17-22(36-37-23)19-7-2-1-3-8-19/h1-3,7-8,11-14,17,24-25,27H,4-6,9-10,15-16,18H2,(H,31,39)(H,32,40)(H,33,38)(H,36,37)(H2,34,35,41)/t24-,25-,27-/m0/s1 |
| InChIKey | WATCGTJRYSVQOG-KLJDGLGGSA-N |
| XLogP | 3.29 |
| TPSA | 157.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.72 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|