C22H29F3N6O — CID 131992243
4-[[(1R,4S)-4-hydroxy-3,3-dimethylcyclohexyl]amino]-2-[[(3E,5E)-3-methyl-6-(methylideneamino)-5-(trifluoromethyl)hexa-3,5-dienyl]amino]pyrimidine-5-carbonitrile (PubChem CID 131992243) has the molecular formula C22H29F3N6O and a molecular weight of 450.51 g/mol. Its IUPAC name is 4-[[(1R,4S)-4-hydroxy-3,3-dimethylcyclohexyl]amino]-2-[[(3E,5E)-3-methyl-6-(methylideneamino)-5-(trifluoromethyl)hexa-3,5-dienyl]amino]pyrimidine-5-carbonitrile.
| Compound Name | 4-[[(1R,4S)-4-hydroxy-3,3-dimethylcyclohexyl]amino]-2-[[(3E,5E)-3-methyl-6-(methylideneamino)-5-(trifluoromethyl)hexa-3,5-dienyl]amino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 131992243 |
| Molecular Formula | C22H29F3N6O |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | 4-[[(1R,4S)-4-hydroxy-3,3-dimethylcyclohexyl]amino]-2-[[(3E,5E)-3-methyl-6-(methylideneamino)-5-(trifluoromethyl)hexa-3,5-dienyl]amino]pyrimidine-5-carbonitrile |
| SMILES | C=N/C=C(\C=C(/C)CCNc1ncc(C#N)c(N[C@@H]2CC[C@H](O)C(C)(C)C2)n1)C(F)(F)F |
| InChI | InChI=1S/C22H29F3N6O/c1-14(9-16(13-27-4)22(23,24)25)7-8-28-20-29-12-15(11-26)19(31-20)30-17-5-6-18(32)21(2,3)10-17/h9,12-13,17-18,32H,4-8,10H2,1-3H3,(H2,28,29,30,31)/b14-9+,16-13+/t17-,18+/m1/s1 |
| InChIKey | ZWZVVRONLLUWDH-TUOWLFJBSA-N |
| XLogP | 4.59 |
| TPSA | 106.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|