C18H31N — CID 131992884
(6Z,8Z)-7-ethyl-N-[(E)-3-methylpent-2-en-2-yl]deca-6,8-dien-2-imine (PubChem CID 131992884) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is (6Z,8Z)-7-ethyl-N-[(E)-3-methylpent-2-en-2-yl]deca-6,8-dien-2-imine.
| Compound Name | (6Z,8Z)-7-ethyl-N-[(E)-3-methylpent-2-en-2-yl]deca-6,8-dien-2-imine |
|---|---|
| PubChem CID | 131992884 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | (6Z,8Z)-7-ethyl-N-[(E)-3-methylpent-2-en-2-yl]deca-6,8-dien-2-imine |
| SMILES | C/C=C\C(=C/CCC/C(C)=N/C(C)=C(\C)CC)CC |
| InChI | InChI=1S/C18H31N/c1-7-12-18(9-3)14-11-10-13-16(5)19-17(6)15(4)8-2/h7,12,14H,8-11,13H2,1-6H3/b12-7-,17-15+,18-14-,19-16+ |
| InChIKey | NEYOVGYMDYZRBP-LLAMXUCJSA-N |
| XLogP | 6.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|