About 2-fluoro-7-methylcyclohepta-1,3,6-trien-1-amine
2-fluoro-7-methylcyclohepta-1,3,6-trien-1-amine (PubChem CID 131992977) has the molecular formula C8H10FN
and a molecular weight of 139.17 g/mol. Its IUPAC name is 2-fluoro-7-methylcyclohepta-1,3,6-trien-1-amine.
Molecular Properties
| Compound Name | 2-fluoro-7-methylcyclohepta-1,3,6-trien-1-amine |
| PubChem CID | 131992977 |
| Molecular Formula | C8H10FN |
| Molecular Weight | 139.17 g/mol |
| Exact Mass | 139.08 |
| IUPAC Name | 2-fluoro-7-methylcyclohepta-1,3,6-trien-1-amine |
| SMILES | CC1=CCC=CC(F)=C1N |
| InChI | InChI=1S/C8H10FN/c1-6-4-2-3-5-7(9)8(6)10/h3-5H,2,10H2,1H3 |
| InChIKey | RAIWORRXNPZMQK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.17 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-fluoro-7-methylcyclohepta-1,3,6-trien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-7-methylcyclohepta-1,3,6-trien-1-amine?
The IUPAC name of 2-fluoro-7-methylcyclohepta-1,3,6-trien-1-amine (CID 131992977) is 2-fluoro-7-methylcyclohepta-1,3,6-trien-1-amine.
What is the SMILES notation for 2-fluoro-7-methylcyclohepta-1,3,6-trien-1-amine?
The canonical SMILES for 2-fluoro-7-methylcyclohepta-1,3,6-trien-1-amine is CC1=CCC=CC(F)=C1N.
What is the InChIKey of 2-fluoro-7-methylcyclohepta-1,3,6-trien-1-amine?
The InChIKey is RAIWORRXNPZMQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10FN/c1-6-4-2-3-5-7(9)8(6)10/h3-5H,2,10H2,1H3.
What are the key properties of 2-fluoro-7-methylcyclohepta-1,3,6-trien-1-amine?
2-fluoro-7-methylcyclohepta-1,3,6-trien-1-amine has a molecular weight of 139.17 g/mol, XLogP of 2.03, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-7-methylcyclohepta-1,3,6-trien-1-amine is sourced from PubChem (CID 131992977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).