C57H36N6 — CID 131993006
2,4,5-tri(carbazol-9-yl)-6-[3-ethenyl-2-[(Z)-prop-1-enyl]indol-1-yl]benzene-1,3-dicarbonitrile (PubChem CID 131993006) has the molecular formula C57H36N6 and a molecular weight of 804.96 g/mol. Its IUPAC name is 2,4,5-tri(carbazol-9-yl)-6-[3-ethenyl-2-[(Z)-prop-1-enyl]indol-1-yl]benzene-1,3-dicarbonitrile.
| Compound Name | 2,4,5-tri(carbazol-9-yl)-6-[3-ethenyl-2-[(Z)-prop-1-enyl]indol-1-yl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 131993006 |
| Molecular Formula | C57H36N6 |
| Molecular Weight | 804.96 g/mol |
| Exact Mass | 804.30 |
| IUPAC Name | 2,4,5-tri(carbazol-9-yl)-6-[3-ethenyl-2-[(Z)-prop-1-enyl]indol-1-yl]benzene-1,3-dicarbonitrile |
| SMILES | C=Cc1c(/C=C\C)n(-c2c(C#N)c(-n3c4ccccc4c4ccccc43)c(C#N)c(-n3c4ccccc4c4ccccc43)c2-n2c3ccccc3c3ccccc32)c2ccccc12 |
| InChI | InChI=1S/C57H36N6/c1-3-19-46-36(4-2)37-20-5-12-27-47(37)61(46)55-44(34-58)54(60-48-28-13-6-21-38(48)39-22-7-14-29-49(39)60)45(35-59)56(62-50-30-15-8-23-40(50)41-24-9-16-31-51(41)62)57(55)63-52-32-17-10-25-42(52)43-26-11-18-33-53(43)63/h3-33H,2H2,1H3/b19-3- |
| InChIKey | RRJMSAINYKEVLO-OQOIWIOPSA-N |
| XLogP | 14.34 |
| TPSA | 67.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.96 |
| LogP ≤ 5 | 14.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |