C13H17N — CID 131993394
1-methyl-6-prop-2-enyl-5,6,7,8-tetrahydroisoquinoline (PubChem CID 131993394) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 1-methyl-6-prop-2-enyl-5,6,7,8-tetrahydroisoquinoline.
| Compound Name | 1-methyl-6-prop-2-enyl-5,6,7,8-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 131993394 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 1-methyl-6-prop-2-enyl-5,6,7,8-tetrahydroisoquinoline |
| SMILES | C=CCC1CCc2c(ccnc2C)C1 |
| InChI | InChI=1S/C13H17N/c1-3-4-11-5-6-13-10(2)14-8-7-12(13)9-11/h3,7-8,11H,1,4-6,9H2,2H3 |
| InChIKey | UZQXFYJHMFOWEL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|