C8H13N3 — CID 131993611
(1Z,3Z)-6-hydrazinyl-5-methylidenehepta-1,3,6-trien-1-amine (PubChem CID 131993611) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is (1Z,3Z)-6-hydrazinyl-5-methylidenehepta-1,3,6-trien-1-amine.
| Compound Name | (1Z,3Z)-6-hydrazinyl-5-methylidenehepta-1,3,6-trien-1-amine |
|---|---|
| PubChem CID | 131993611 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | (1Z,3Z)-6-hydrazinyl-5-methylidenehepta-1,3,6-trien-1-amine |
| SMILES | C=C(/C=C\C=C/N)C(=C)NN |
| InChI | InChI=1S/C8H13N3/c1-7(8(2)11-10)5-3-4-6-9/h3-6,11H,1-2,9-10H2/b5-3-,6-4- |
| InChIKey | COFZLTZDDFOAQI-GLIMQPGKSA-N |
| XLogP | 0.55 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|