C17H13ClF3N3 — CID 1319941
10-(4-chlorophenyl)-11-methyl-2-(trifluoromethyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene (PubChem CID 1319941) has the molecular formula C17H13ClF3N3 and a molecular weight of 351.76 g/mol. Its IUPAC name is 10-(4-chlorophenyl)-11-methyl-2-(trifluoromethyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene.
| Compound Name | 10-(4-chlorophenyl)-11-methyl-2-(trifluoromethyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene |
|---|---|
| PubChem CID | 1319941 |
| Molecular Formula | C17H13ClF3N3 |
| Molecular Weight | 351.76 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 10-(4-chlorophenyl)-11-methyl-2-(trifluoromethyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene |
| SMILES | Cc1nn2c(C(F)(F)F)c3c(nc2c1-c1ccc(Cl)cc1)CCC3 |
| InChI | InChI=1S/C17H13ClF3N3/c1-9-14(10-5-7-11(18)8-6-10)16-22-13-4-2-3-12(13)15(17(19,20)21)24(16)23-9/h5-8H,2-4H2,1H3 |
| InChIKey | ONMPYEKLNCWFBC-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.76 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |