C18H19N5O2 — CID 131994380
3-[7-(aminomethyl)-4-morpholin-4-ylpyrido[3,2-d]pyrimidin-2-yl]phenol (PubChem CID 131994380) has the molecular formula C18H19N5O2 and a molecular weight of 337.38 g/mol. Its IUPAC name is 3-[7-(aminomethyl)-4-morpholin-4-ylpyrido[3,2-d]pyrimidin-2-yl]phenol.
| Compound Name | 3-[7-(aminomethyl)-4-morpholin-4-ylpyrido[3,2-d]pyrimidin-2-yl]phenol |
|---|---|
| PubChem CID | 131994380 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 3-[7-(aminomethyl)-4-morpholin-4-ylpyrido[3,2-d]pyrimidin-2-yl]phenol |
| SMILES | NCc1cnc2c(N3CCOCC3)nc(-c3cccc(O)c3)nc2c1 |
| InChI | InChI=1S/C18H19N5O2/c19-10-12-8-15-16(20-11-12)18(23-4-6-25-7-5-23)22-17(21-15)13-2-1-3-14(24)9-13/h1-3,8-9,11,24H,4-7,10,19H2 |
| InChIKey | UHFDWUPTHITCPB-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |