C13H21F2NO2 — CID 131994449
2-[(2Z,4Z,6Z)-2,7-difluoro-6-propoxyocta-2,4,6-trien-3-yl]oxyethanamine (PubChem CID 131994449) has the molecular formula C13H21F2NO2 and a molecular weight of 261.31 g/mol. Its IUPAC name is 2-[(2Z,4Z,6Z)-2,7-difluoro-6-propoxyocta-2,4,6-trien-3-yl]oxyethanamine.
| Compound Name | 2-[(2Z,4Z,6Z)-2,7-difluoro-6-propoxyocta-2,4,6-trien-3-yl]oxyethanamine |
|---|---|
| PubChem CID | 131994449 |
| Molecular Formula | C13H21F2NO2 |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 2-[(2Z,4Z,6Z)-2,7-difluoro-6-propoxyocta-2,4,6-trien-3-yl]oxyethanamine |
| SMILES | CCCOC(/C=C\C(OCCN)=C(/C)F)=C(/C)F |
| InChI | InChI=1S/C13H21F2NO2/c1-4-8-17-12(10(2)14)5-6-13(11(3)15)18-9-7-16/h5-6H,4,7-9,16H2,1-3H3/b6-5-,12-10-,13-11- |
| InChIKey | POWLPXOTMGEGDR-ABBWKIGLSA-N |
| XLogP | 3.35 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|