C12H12N6 — CID 13199460
6-N-methyl-8-N-phenyl-7H-purine-6,8-diamine (PubChem CID 13199460) has the molecular formula C12H12N6 and a molecular weight of 240.27 g/mol. Its IUPAC name is 6-N-methyl-8-N-phenyl-7H-purine-6,8-diamine.
| Compound Name | 6-N-methyl-8-N-phenyl-7H-purine-6,8-diamine |
|---|---|
| PubChem CID | 13199460 |
| Molecular Formula | C12H12N6 |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 6-N-methyl-8-N-phenyl-7H-purine-6,8-diamine |
| SMILES | CNc1ncnc2nc(Nc3ccccc3)[nH]c12 |
| InChI | InChI=1S/C12H12N6/c1-13-10-9-11(15-7-14-10)18-12(17-9)16-8-5-3-2-4-6-8/h2-7H,1H3,(H3,13,14,15,16,17,18) |
| InChIKey | VTCRGXBZXAJTGH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |