C29H42N10O6 — CID 131994770
N-[(2S)-5-(diaminomethylideneamino)-1-[3-[[(2R)-5-(diaminomethylideneamino)pentan-2-yl]carbamoyl]-4-methoxyanilino]-1-oxopentan-2-yl]-5-formamido-2-methoxybenzamide (PubChem CID 131994770) has the molecular formula C29H42N10O6 and a molecular weight of 626.72 g/mol. Its IUPAC name is N-[(2S)-5-(diaminomethylideneamino)-1-[3-[[(2R)-5-(diaminomethylideneamino)pentan-2-yl]carbamoyl]-4-methoxyanilino]-1-oxopentan-2-yl]-5-formamido-2-methoxybenzamide.
| Compound Name | N-[(2S)-5-(diaminomethylideneamino)-1-[3-[[(2R)-5-(diaminomethylideneamino)pentan-2-yl]carbamoyl]-4-methoxyanilino]-1-oxopentan-2-yl]-5-formamido-2-methoxybenzamide |
|---|---|
| PubChem CID | 131994770 |
| Molecular Formula | C29H42N10O6 |
| Molecular Weight | 626.72 g/mol |
| Exact Mass | 626.33 |
| IUPAC Name | N-[(2S)-5-(diaminomethylideneamino)-1-[3-[[(2R)-5-(diaminomethylideneamino)pentan-2-yl]carbamoyl]-4-methoxyanilino]-1-oxopentan-2-yl]-5-formamido-2-methoxybenzamide |
| SMILES | COc1ccc(NC(=O)[C@H](CCCN=C(N)N)NC(=O)c2cc(NC=O)ccc2OC)cc1C(=O)N[C@H](C)CCCN=C(N)N |
| InChI | InChI=1S/C29H42N10O6/c1-17(6-4-12-34-28(30)31)37-25(41)21-15-19(9-11-24(21)45-3)38-27(43)22(7-5-13-35-29(32)33)39-26(42)20-14-18(36-16-40)8-10-23(20)44-2/h8-11,14-17,22H,4-7,12-13H2,1-3H3,(H,36,40)(H,37,41)(H,38,43)(H,39,42)(H4,30,31,34)(H4,32,33,35)/t17-,22+/m1/s1 |
| InChIKey | KLWSKPNLABISTQ-VGSWGCGISA-N |
| XLogP | 0.23 |
| TPSA | 263.66 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.72 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|