C43H41N3 — CID 131994960
N-[4-[(E)-[cyclohexa-1,3-dien-1-yl(cyclohexa-1,5-dien-1-yl)hydrazinylidene]methyl]phenyl]-N-(2,2-diphenylethenyl)-5,6,7,8-tetrahydronaphthalen-1-amine (PubChem CID 131994960) has the molecular formula C43H41N3 and a molecular weight of 599.82 g/mol. Its IUPAC name is N-[4-[(E)-[cyclohexa-1,3-dien-1-yl(cyclohexa-1,5-dien-1-yl)hydrazinylidene]methyl]phenyl]-N-(2,2-diphenylethenyl)-5,6,7,8-tetrahydronaphthalen-1-amine.
| Compound Name | N-[4-[(E)-[cyclohexa-1,3-dien-1-yl(cyclohexa-1,5-dien-1-yl)hydrazinylidene]methyl]phenyl]-N-(2,2-diphenylethenyl)-5,6,7,8-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 131994960 |
| Molecular Formula | C43H41N3 |
| Molecular Weight | 599.82 g/mol |
| Exact Mass | 599.33 |
| IUPAC Name | N-[4-[(E)-[cyclohexa-1,3-dien-1-yl(cyclohexa-1,5-dien-1-yl)hydrazinylidene]methyl]phenyl]-N-(2,2-diphenylethenyl)-5,6,7,8-tetrahydronaphthalen-1-amine |
| SMILES | C1=CCCC(N(/N=C/c2ccc(N(C=C(c3ccccc3)c3ccccc3)c3cccc4c3CCCC4)cc2)C2=CCCC=C2)=C1 |
| InChI | InChI=1S/C43H41N3/c1-5-16-36(17-6-1)42(37-18-7-2-8-19-37)33-45(43-27-15-21-35-20-13-14-26-41(35)43)38-30-28-34(29-31-38)32-44-46(39-22-9-3-10-23-39)40-24-11-4-12-25-40/h1-3,5-9,11,15-19,21-22,24-25,27-33H,4,10,12-14,20,23,26H2/b44-32+ |
| InChIKey | UDPRYKSYHFCUKW-CMXZEOLJSA-N |
| XLogP | 10.90 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.82 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenone(7)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|