C41H37N3 — CID 131994994
N-(2,2-diphenylethenyl)-4-[(E)-(diphenylhydrazinylidene)methyl]-3-methyl-N-(4-methylcyclohexa-1,3-dien-1-yl)aniline (PubChem CID 131994994) has the molecular formula C41H37N3 and a molecular weight of 571.77 g/mol. Its IUPAC name is N-(2,2-diphenylethenyl)-4-[(E)-(diphenylhydrazinylidene)methyl]-3-methyl-N-(4-methylcyclohexa-1,3-dien-1-yl)aniline.
| Compound Name | N-(2,2-diphenylethenyl)-4-[(E)-(diphenylhydrazinylidene)methyl]-3-methyl-N-(4-methylcyclohexa-1,3-dien-1-yl)aniline |
|---|---|
| PubChem CID | 131994994 |
| Molecular Formula | C41H37N3 |
| Molecular Weight | 571.77 g/mol |
| Exact Mass | 571.30 |
| IUPAC Name | N-(2,2-diphenylethenyl)-4-[(E)-(diphenylhydrazinylidene)methyl]-3-methyl-N-(4-methylcyclohexa-1,3-dien-1-yl)aniline |
| SMILES | CC1=CC=C(N(C=C(c2ccccc2)c2ccccc2)c2ccc(/C=N/N(c3ccccc3)c3ccccc3)c(C)c2)CC1 |
| InChI | InChI=1S/C41H37N3/c1-32-23-26-37(27-24-32)43(31-41(34-15-7-3-8-16-34)35-17-9-4-10-18-35)40-28-25-36(33(2)29-40)30-42-44(38-19-11-5-12-20-38)39-21-13-6-14-22-39/h3-23,25-26,28-31H,24,27H2,1-2H3/b42-30+ |
| InChIKey | GXTZPZZHKTXSGA-OJZPPULMSA-N |
| XLogP | 10.69 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.77 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenone(7)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|