C27H29F3N6O4 — CID 131995181
2-ethoxy-N-[(3S)-oxolan-3-yl]-5-[4,7,7-trimethyl-5-oxo-6-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrrolo[3,4-b]pyridin-2-yl]pyridine-3-carboxamide (PubChem CID 131995181) has the molecular formula C27H29F3N6O4 and a molecular weight of 558.56 g/mol. Its IUPAC name is 2-ethoxy-N-[(3S)-oxolan-3-yl]-5-[4,7,7-trimethyl-5-oxo-6-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrrolo[3,4-b]pyridin-2-yl]pyridine-3-carboxamide.
| Compound Name | 2-ethoxy-N-[(3S)-oxolan-3-yl]-5-[4,7,7-trimethyl-5-oxo-6-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrrolo[3,4-b]pyridin-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 131995181 |
| Molecular Formula | C27H29F3N6O4 |
| Molecular Weight | 558.56 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | 2-ethoxy-N-[(3S)-oxolan-3-yl]-5-[4,7,7-trimethyl-5-oxo-6-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrrolo[3,4-b]pyridin-2-yl]pyridine-3-carboxamide |
| SMILES | CCOc1ncc(-c2cc(C)c3c(n2)C(C)(C)N(c2cnn(CC(F)(F)F)c2)C3=O)cc1C(=O)N[C@H]1CCOC1 |
| InChI | InChI=1S/C27H29F3N6O4/c1-5-40-24-19(23(37)33-17-6-7-39-13-17)9-16(10-31-24)20-8-15(2)21-22(34-20)26(3,4)36(25(21)38)18-11-32-35(12-18)14-27(28,29)30/h8-12,17H,5-7,13-14H2,1-4H3,(H,33,37)/t17-/m0/s1 |
| InChIKey | OPWDLHFOEZDYDV-KRWDZBQOSA-N |
| XLogP | 4.02 |
| TPSA | 111.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.56 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |