C22H29F — CID 131995415
2-[(2E,4E)-2-fluoro-4-[(E)-pent-2-en-3-yl]hepta-2,4,6-trienyl]-5-propylcyclohepta-1,3,5-triene (PubChem CID 131995415) has the molecular formula C22H29F and a molecular weight of 312.47 g/mol. Its IUPAC name is 2-[(2E,4E)-2-fluoro-4-[(E)-pent-2-en-3-yl]hepta-2,4,6-trienyl]-5-propylcyclohepta-1,3,5-triene.
| Compound Name | 2-[(2E,4E)-2-fluoro-4-[(E)-pent-2-en-3-yl]hepta-2,4,6-trienyl]-5-propylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 131995415 |
| Molecular Formula | C22H29F |
| Molecular Weight | 312.47 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | 2-[(2E,4E)-2-fluoro-4-[(E)-pent-2-en-3-yl]hepta-2,4,6-trienyl]-5-propylcyclohepta-1,3,5-triene |
| SMILES | C=C/C=C(\C=C(\F)CC1=CCC=C(CCC)C=C1)C(=C/C)/CC |
| InChI | InChI=1S/C22H29F/c1-5-10-18-12-9-13-19(15-14-18)16-22(23)17-21(11-6-2)20(7-3)8-4/h6-7,11-15,17H,2,5,8-10,16H2,1,3-4H3/b20-7+,21-11+,22-17+ |
| InChIKey | RATGUSOYDAGKSN-COJSYYDFSA-N |
| XLogP | 7.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.47 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|