C12H19N — CID 131995510
2-[(1Z)-buta-1,3-dienyl]-N,N,3-trimethylcyclopent-2-en-1-amine (PubChem CID 131995510) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 2-[(1Z)-buta-1,3-dienyl]-N,N,3-trimethylcyclopent-2-en-1-amine.
| Compound Name | 2-[(1Z)-buta-1,3-dienyl]-N,N,3-trimethylcyclopent-2-en-1-amine |
|---|---|
| PubChem CID | 131995510 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 2-[(1Z)-buta-1,3-dienyl]-N,N,3-trimethylcyclopent-2-en-1-amine |
| SMILES | C=C/C=C\C1=C(C)CCC1N(C)C |
| InChI | InChI=1S/C12H19N/c1-5-6-7-11-10(2)8-9-12(11)13(3)4/h5-7,12H,1,8-9H2,2-4H3/b7-6- |
| InChIKey | LSECYCWFEQDUEV-SREVYHEPSA-N |
| XLogP | 2.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|