C12H19F2N — CID 131995515
(5Z)-3-(2,2-difluoropropyl)-4-methylocta-1,5,7-trien-2-amine (PubChem CID 131995515) has the molecular formula C12H19F2N and a molecular weight of 215.29 g/mol. Its IUPAC name is (5Z)-3-(2,2-difluoropropyl)-4-methylocta-1,5,7-trien-2-amine.
| Compound Name | (5Z)-3-(2,2-difluoropropyl)-4-methylocta-1,5,7-trien-2-amine |
|---|---|
| PubChem CID | 131995515 |
| Molecular Formula | C12H19F2N |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | (5Z)-3-(2,2-difluoropropyl)-4-methylocta-1,5,7-trien-2-amine |
| SMILES | C=C/C=C\C(C)C(CC(C)(F)F)C(=C)N |
| InChI | InChI=1S/C12H19F2N/c1-5-6-7-9(2)11(10(3)15)8-12(4,13)14/h5-7,9,11H,1,3,8,15H2,2,4H3/b7-6- |
| InChIKey | UOXBBDWTHZXDFV-SREVYHEPSA-N |
| XLogP | 3.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|