About trimethyl(8-tricyclo[5.2.1.02,6]decanyl)silane
trimethyl(8-tricyclo[5.2.1.02,6]decanyl)silane (PubChem CID 13199555) has the molecular formula C13H24Si
and a molecular weight of 208.42 g/mol. Its IUPAC name is trimethyl(8-tricyclo[5.2.1.02,6]decanyl)silane.
Molecular Properties
| Compound Name | trimethyl(8-tricyclo[5.2.1.02,6]decanyl)silane |
| PubChem CID | 13199555 |
| Molecular Formula | C13H24Si |
| Molecular Weight | 208.42 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | trimethyl(8-tricyclo[5.2.1.02,6]decanyl)silane |
| SMILES | C[Si](C)(C)C1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C13H24Si/c1-14(2,3)13-8-9-7-12(13)11-6-4-5-10(9)11/h9-13H,4-8H2,1-3H3 |
| InChIKey | XPYIXXUNEJXCOR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl(8-tricyclo[5.2.1.02,6]decanyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl(8-tricyclo[5.2.1.02,6]decanyl)silane?
The IUPAC name of trimethyl(8-tricyclo[5.2.1.02,6]decanyl)silane (CID 13199555) is trimethyl(8-tricyclo[5.2.1.02,6]decanyl)silane.
What is the SMILES notation for trimethyl(8-tricyclo[5.2.1.02,6]decanyl)silane?
The canonical SMILES for trimethyl(8-tricyclo[5.2.1.02,6]decanyl)silane is C[Si](C)(C)C1CC2CC1C1CCCC21.
What is the InChIKey of trimethyl(8-tricyclo[5.2.1.02,6]decanyl)silane?
The InChIKey is XPYIXXUNEJXCOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24Si/c1-14(2,3)13-8-9-7-12(13)11-6-4-5-10(9)11/h9-13H,4-8H2,1-3H3.
What are the key properties of trimethyl(8-tricyclo[5.2.1.02,6]decanyl)silane?
trimethyl(8-tricyclo[5.2.1.02,6]decanyl)silane has a molecular weight of 208.42 g/mol, XLogP of 4.15, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl(8-tricyclo[5.2.1.02,6]decanyl)silane is sourced from PubChem (CID 13199555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).