C12H21N — CID 131995734
(3Z,5Z)-N-ethyl-N,3,5-trimethylhepta-1,3,5-trien-2-amine (PubChem CID 131995734) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is (3Z,5Z)-N-ethyl-N,3,5-trimethylhepta-1,3,5-trien-2-amine.
| Compound Name | (3Z,5Z)-N-ethyl-N,3,5-trimethylhepta-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 131995734 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (3Z,5Z)-N-ethyl-N,3,5-trimethylhepta-1,3,5-trien-2-amine |
| SMILES | C=C(/C(C)=C\C(C)=C/C)N(C)CC |
| InChI | InChI=1S/C12H21N/c1-7-10(3)9-11(4)12(5)13(6)8-2/h7,9H,5,8H2,1-4,6H3/b10-7-,11-9- |
| InChIKey | ORIQUNLLTFSWAS-HDEMWOFXSA-N |
| XLogP | 3.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|