C17H27FN2 — CID 131995787
1-[(3Z,5E)-3-cyclopropyl-5-(2-fluoropropan-2-yl)hepta-1,3,5-trien-2-yl]piperazine (PubChem CID 131995787) has the molecular formula C17H27FN2 and a molecular weight of 278.41 g/mol. Its IUPAC name is 1-[(3Z,5E)-3-cyclopropyl-5-(2-fluoropropan-2-yl)hepta-1,3,5-trien-2-yl]piperazine.
| Compound Name | 1-[(3Z,5E)-3-cyclopropyl-5-(2-fluoropropan-2-yl)hepta-1,3,5-trien-2-yl]piperazine |
|---|---|
| PubChem CID | 131995787 |
| Molecular Formula | C17H27FN2 |
| Molecular Weight | 278.41 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 1-[(3Z,5E)-3-cyclopropyl-5-(2-fluoropropan-2-yl)hepta-1,3,5-trien-2-yl]piperazine |
| SMILES | C=C(/C(=C\C(=C/C)C(C)(C)F)C1CC1)N1CCNCC1 |
| InChI | InChI=1S/C17H27FN2/c1-5-15(17(3,4)18)12-16(14-6-7-14)13(2)20-10-8-19-9-11-20/h5,12,14,19H,2,6-11H2,1,3-4H3/b15-5+,16-12+ |
| InChIKey | QTXDKHTTXUVLLW-ISONPCNLSA-N |
| XLogP | 3.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|