C29H49N5 — CID 131995884
(1Z,3E)-5-N-[1-(dimethylamino)ethenyl]-4-[1-[3-[(2Z,4Z)-2,4-dimethylhexa-2,4-dienyl]imidazolidin-1-yl]ethenyl]-5-N-(4-methylpent-1-en-3-yl)hexa-1,3-diene-1,5-diamine (PubChem CID 131995884) has the molecular formula C29H49N5 and a molecular weight of 467.75 g/mol. Its IUPAC name is (1Z,3E)-5-N-[1-(dimethylamino)ethenyl]-4-[1-[3-[(2Z,4Z)-2,4-dimethylhexa-2,4-dienyl]imidazolidin-1-yl]ethenyl]-5-N-(4-methylpent-1-en-3-yl)hexa-1,3-diene-1,5-diamine.
| Compound Name | (1Z,3E)-5-N-[1-(dimethylamino)ethenyl]-4-[1-[3-[(2Z,4Z)-2,4-dimethylhexa-2,4-dienyl]imidazolidin-1-yl]ethenyl]-5-N-(4-methylpent-1-en-3-yl)hexa-1,3-diene-1,5-diamine |
|---|---|
| PubChem CID | 131995884 |
| Molecular Formula | C29H49N5 |
| Molecular Weight | 467.75 g/mol |
| Exact Mass | 467.40 |
| IUPAC Name | (1Z,3E)-5-N-[1-(dimethylamino)ethenyl]-4-[1-[3-[(2Z,4Z)-2,4-dimethylhexa-2,4-dienyl]imidazolidin-1-yl]ethenyl]-5-N-(4-methylpent-1-en-3-yl)hexa-1,3-diene-1,5-diamine |
| SMILES | C=CC(C(C)C)N(C(=C)N(C)C)C(C)/C(=C\C=C/N)C(=C)N1CCN(C/C(C)=C\C(C)=C/C)C1 |
| InChI | InChI=1S/C29H49N5/c1-12-23(5)19-24(6)20-32-17-18-33(21-32)25(7)28(15-14-16-30)26(8)34(27(9)31(10)11)29(13-2)22(3)4/h12-16,19,22,26,29H,2,7,9,17-18,20-21,30H2,1,3-6,8,10-11H3/b16-14-,23-12-,24-19-,28-15- |
| InChIKey | ADMDMGFOKHUVIK-AUHDMILZSA-N |
| XLogP | 5.32 |
| TPSA | 38.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.75 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|