C20H30N4 — CID 131995943
(2Z)-2-[1-[4-[(Z,4Z)-2-methyl-4-[(methylideneamino)methylidene]hex-2-enyl]piperazin-1-yl]ethenyl]penta-2,4-dien-1-imine (PubChem CID 131995943) has the molecular formula C20H30N4 and a molecular weight of 326.49 g/mol. Its IUPAC name is (2Z)-2-[1-[4-[(Z,4Z)-2-methyl-4-[(methylideneamino)methylidene]hex-2-enyl]piperazin-1-yl]ethenyl]penta-2,4-dien-1-imine.
| Compound Name | (2Z)-2-[1-[4-[(Z,4Z)-2-methyl-4-[(methylideneamino)methylidene]hex-2-enyl]piperazin-1-yl]ethenyl]penta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 131995943 |
| Molecular Formula | C20H30N4 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | (2Z)-2-[1-[4-[(Z,4Z)-2-methyl-4-[(methylideneamino)methylidene]hex-2-enyl]piperazin-1-yl]ethenyl]penta-2,4-dien-1-imine |
| SMILES | [H]/N=C/C(=C\C=C)C(=C)N1CCN(C/C(C)=C\C(=C/N=C)CC)CC1 |
| InChI | InChI=1S/C20H30N4/c1-6-8-20(14-21)18(4)24-11-9-23(10-12-24)16-17(3)13-19(7-2)15-22-5/h6,8,13-15,21H,1,4-5,7,9-12,16H2,2-3H3/b17-13-,19-15-,20-8+,21-14+ |
| InChIKey | UTFQSUHKNJMVLJ-XGSPOQQLSA-N |
| XLogP | 3.82 |
| TPSA | 42.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|