C17H21F2N — CID 131996018
(1E,3Z,5Z)-8-(4,4-difluoro-3-methylidenecyclohexa-1,5-dien-1-yl)-3-ethylocta-1,3,5-trien-1-amine (PubChem CID 131996018) has the molecular formula C17H21F2N and a molecular weight of 277.36 g/mol. Its IUPAC name is (1E,3Z,5Z)-8-(4,4-difluoro-3-methylidenecyclohexa-1,5-dien-1-yl)-3-ethylocta-1,3,5-trien-1-amine.
| Compound Name | (1E,3Z,5Z)-8-(4,4-difluoro-3-methylidenecyclohexa-1,5-dien-1-yl)-3-ethylocta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 131996018 |
| Molecular Formula | C17H21F2N |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | (1E,3Z,5Z)-8-(4,4-difluoro-3-methylidenecyclohexa-1,5-dien-1-yl)-3-ethylocta-1,3,5-trien-1-amine |
| SMILES | C=C1C=C(CC/C=C\C=C(/C=C/N)CC)C=CC1(F)F |
| InChI | InChI=1S/C17H21F2N/c1-3-15(10-12-20)7-5-4-6-8-16-9-11-17(18,19)14(2)13-16/h4-5,7,9-13H,2-3,6,8,20H2,1H3/b5-4-,12-10+,15-7- |
| InChIKey | JIDUINJEFCLKPQ-ZZFCLPFGSA-N |
| XLogP | 4.82 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|