C18H29NO4 — CID 131996611
(2S)-2-[[(1S,2R,3R,5S)-2-but-3-enyl-3-bicyclo[3.2.0]heptanyl]oxycarbonylamino]-3,3-dimethylbutanoic acid (PubChem CID 131996611) has the molecular formula C18H29NO4 and a molecular weight of 323.43 g/mol. Its IUPAC name is (2S)-2-[[(1S,2R,3R,5S)-2-but-3-enyl-3-bicyclo[3.2.0]heptanyl]oxycarbonylamino]-3,3-dimethylbutanoic acid.
| Compound Name | (2S)-2-[[(1S,2R,3R,5S)-2-but-3-enyl-3-bicyclo[3.2.0]heptanyl]oxycarbonylamino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 131996611 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | (2S)-2-[[(1S,2R,3R,5S)-2-but-3-enyl-3-bicyclo[3.2.0]heptanyl]oxycarbonylamino]-3,3-dimethylbutanoic acid |
| SMILES | C=CCC[C@@H]1[C@H]2CC[C@H]2C[C@H]1OC(=O)N[C@H](C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C18H29NO4/c1-5-6-7-13-12-9-8-11(12)10-14(13)23-17(22)19-15(16(20)21)18(2,3)4/h5,11-15H,1,6-10H2,2-4H3,(H,19,22)(H,20,21)/t11-,12-,13+,14+,15+/m0/s1 |
| InChIKey | FHHTVLQKSHVNPU-VQJWOFKYSA-N |
| XLogP | 3.59 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|