C16H17N3O10S — CID 131997089
2-[6-(hydroperoxymethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-N-(5-nitro-1,3-thiazol-2-yl)benzamide (PubChem CID 131997089) has the molecular formula C16H17N3O10S and a molecular weight of 443.39 g/mol. Its IUPAC name is 2-[6-(hydroperoxymethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-N-(5-nitro-1,3-thiazol-2-yl)benzamide.
| Compound Name | 2-[6-(hydroperoxymethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-N-(5-nitro-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 131997089 |
| Molecular Formula | C16H17N3O10S |
| Molecular Weight | 443.39 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | 2-[6-(hydroperoxymethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-N-(5-nitro-1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1ncc([N+](=O)[O-])s1)c1ccccc1OC1OC(COO)C(O)C(O)C1O |
| InChI | InChI=1S/C16H17N3O10S/c20-11-9(6-27-26)29-15(13(22)12(11)21)28-8-4-2-1-3-7(8)14(23)18-16-17-5-10(30-16)19(24)25/h1-5,9,11-13,15,20-22,26H,6H2,(H,17,18,23) |
| InChIKey | UYNMQVNAHYKVKM-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 193.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.39 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|