C13H25FN2O2 — CID 131997090
tert-butyl 3-(2-aminoethyl)-4-fluoro-4-methylpiperidine-1-carboxylate (PubChem CID 131997090) has the molecular formula C13H25FN2O2 and a molecular weight of 260.35 g/mol. Its IUPAC name is tert-butyl 3-(2-aminoethyl)-4-fluoro-4-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(2-aminoethyl)-4-fluoro-4-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 131997090 |
| Molecular Formula | C13H25FN2O2 |
| Molecular Weight | 260.35 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | tert-butyl 3-(2-aminoethyl)-4-fluoro-4-methylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C)(F)C(CCN)C1 |
| InChI | InChI=1S/C13H25FN2O2/c1-12(2,3)18-11(17)16-8-6-13(4,14)10(9-16)5-7-15/h10H,5-9,15H2,1-4H3 |
| InChIKey | NLGAENDTOOUUQN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |